C23H24N6O2S — CID 139427318
4-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-1H-indole-2,3-dione (PubChem CID 139427318) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-1H-indole-2,3-dione.
| Compound Name | 4-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 139427318 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-1H-indole-2,3-dione |
| SMILES | N[C@@H]1CCCC12CCN(c1ncc(Sc3cccc4c3C(=O)C(=O)N4)c3nccn13)CC2 |
| InChI | InChI=1S/C23H24N6O2S/c24-17-5-2-6-23(17)7-10-28(11-8-23)22-26-13-16(20-25-9-12-29(20)22)32-15-4-1-3-14-18(15)19(30)21(31)27-14/h1,3-4,9,12-13,17H,2,5-8,10-11,24H2,(H,27,30,31)/t17-/m1/s1 |
| InChIKey | HVHHWYFINUCVHQ-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|