C20H25N7S — CID 139427348
(4R)-8-[8-(4-aminophenyl)sulfanyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine (PubChem CID 139427348) has the molecular formula C20H25N7S and a molecular weight of 395.54 g/mol. Its IUPAC name is (4R)-8-[8-(4-aminophenyl)sulfanyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4R)-8-[8-(4-aminophenyl)sulfanyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 139427348 |
| Molecular Formula | C20H25N7S |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (4R)-8-[8-(4-aminophenyl)sulfanyl-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine |
| SMILES | Nc1ccc(Sc2cnc(N3CCC4(CCC[C@H]4N)CC3)n3cnnc23)cc1 |
| InChI | InChI=1S/C20H25N7S/c21-14-3-5-15(6-4-14)28-16-12-23-19(27-13-24-25-18(16)27)26-10-8-20(9-11-26)7-1-2-17(20)22/h3-6,12-13,17H,1-2,7-11,21-22H2/t17-/m1/s1 |
| InChIKey | XJVWZSNGWHSDJX-QGZVFWFLSA-N |
| XLogP | 2.96 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|