C20H23Cl2N7S — CID 139427661
(4R)-8-[8-[(6-amino-2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine (PubChem CID 139427661) has the molecular formula C20H23Cl2N7S and a molecular weight of 464.43 g/mol. Its IUPAC name is (4R)-8-[8-[(6-amino-2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4R)-8-[8-[(6-amino-2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 139427661 |
| Molecular Formula | C20H23Cl2N7S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | (4R)-8-[8-[(6-amino-2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine |
| SMILES | Nc1cc(Sc2cnc(N3CCC4(CCC[C@H]4N)CC3)n3ccnc23)c(Cl)c(Cl)n1 |
| InChI | InChI=1S/C20H23Cl2N7S/c21-16-12(10-15(24)27-17(16)22)30-13-11-26-19(29-9-6-25-18(13)29)28-7-4-20(5-8-28)3-1-2-14(20)23/h6,9-11,14H,1-5,7-8,23H2,(H2,24,27)/t14-/m1/s1 |
| InChIKey | OXORHIUSUONRQJ-CQSZACIVSA-N |
| XLogP | 4.26 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|