C20H22ClFN6S — CID 139427716
(4R)-8-[8-[(3-chloro-2-fluoro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine (PubChem CID 139427716) has the molecular formula C20H22ClFN6S and a molecular weight of 432.96 g/mol. Its IUPAC name is (4R)-8-[8-[(3-chloro-2-fluoro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4R)-8-[8-[(3-chloro-2-fluoro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 139427716 |
| Molecular Formula | C20H22ClFN6S |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (4R)-8-[8-[(3-chloro-2-fluoro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-8-azaspiro[4.5]decan-4-amine |
| SMILES | N[C@@H]1CCCC12CCN(c1ncc(Sc3ccnc(F)c3Cl)c3nccn13)CC2 |
| InChI | InChI=1S/C20H22ClFN6S/c21-16-13(3-7-24-17(16)22)29-14-12-26-19(28-11-8-25-18(14)28)27-9-5-20(6-10-27)4-1-2-15(20)23/h3,7-8,11-12,15H,1-2,4-6,9-10,23H2/t15-/m1/s1 |
| InChIKey | GFQQBNHDIPXPBE-OAHLLOKOSA-N |
| XLogP | 4.17 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|