C31H58N2 — CID 139428116
5-N-tert-butyl-2-N,7,7-trimethyl-6-methylidene-2-N-(2,2,8,8-tetramethyl-3,7-dimethylidenenonan-4-yl)oct-1-ene-2,5-diamine (PubChem CID 139428116) has the molecular formula C31H58N2 and a molecular weight of 458.82 g/mol. Its IUPAC name is 5-N-tert-butyl-2-N,7,7-trimethyl-6-methylidene-2-N-(2,2,8,8-tetramethyl-3,7-dimethylidenenonan-4-yl)oct-1-ene-2,5-diamine.
| Compound Name | 5-N-tert-butyl-2-N,7,7-trimethyl-6-methylidene-2-N-(2,2,8,8-tetramethyl-3,7-dimethylidenenonan-4-yl)oct-1-ene-2,5-diamine |
|---|---|
| PubChem CID | 139428116 |
| Molecular Formula | C31H58N2 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 458.46 |
| IUPAC Name | 5-N-tert-butyl-2-N,7,7-trimethyl-6-methylidene-2-N-(2,2,8,8-tetramethyl-3,7-dimethylidenenonan-4-yl)oct-1-ene-2,5-diamine |
| SMILES | C=C(CCC(NC(C)(C)C)C(=C)C(C)(C)C)N(C)C(CCC(=C)C(C)(C)C)C(=C)C(C)(C)C |
| InChI | InChI=1S/C31H58N2/c1-22(28(5,6)7)18-21-27(25(4)30(11,12)13)33(17)23(2)19-20-26(32-31(14,15)16)24(3)29(8,9)10/h26-27,32H,1-4,18-21H2,5-17H3 |
| InChIKey | LEQFEZHNFCIDDV-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|