C25H32ClN5O2S — CID 139428722
2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)-N-[[6-[3-[(3S)-5,5-dimethylpyrrolidin-3-yl]propylamino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide (PubChem CID 139428722) has the molecular formula C25H32ClN5O2S and a molecular weight of 502.08 g/mol. Its IUPAC name is 2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)-N-[[6-[3-[(3S)-5,5-dimethylpyrrolidin-3-yl]propylamino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)-N-[[6-[3-[(3S)-5,5-dimethylpyrrolidin-3-yl]propylamino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139428722 |
| Molecular Formula | C25H32ClN5O2S |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)-N-[[6-[3-[(3S)-5,5-dimethylpyrrolidin-3-yl]propylamino]-2-pyridinyl]sulfanyl]pyridine-3-carboxamide |
| SMILES | CC1(C)C[C@H](CCCNc2cccc(SNC(=O)c3ccc(C4=CCCCO4)nc3Cl)n2)CN1 |
| InChI | InChI=1S/C25H32ClN5O2S/c1-25(2)15-17(16-28-25)7-6-13-27-21-9-5-10-22(30-21)34-31-24(32)18-11-12-19(29-23(18)26)20-8-3-4-14-33-20/h5,8-12,17,28H,3-4,6-7,13-16H2,1-2H3,(H,27,30)(H,31,32)/t17-/m0/s1 |
| InChIKey | CVESHZKGHBUVKE-KRWDZBQOSA-N |
| XLogP | 5.30 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|