C19H25ClN6O3S — CID 139428795
4-chloro-22,22-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,18,24-hexazatetracyclo[18.2.1.111,14.02,7]tetracosa-2(7),3,5,11(24),12-pentaen-8-one (PubChem CID 139428795) has the molecular formula C19H25ClN6O3S and a molecular weight of 452.97 g/mol. Its IUPAC name is 4-chloro-22,22-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,18,24-hexazatetracyclo[18.2.1.111,14.02,7]tetracosa-2(7),3,5,11(24),12-pentaen-8-one.
| Compound Name | 4-chloro-22,22-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,18,24-hexazatetracyclo[18.2.1.111,14.02,7]tetracosa-2(7),3,5,11(24),12-pentaen-8-one |
|---|---|
| PubChem CID | 139428795 |
| Molecular Formula | C19H25ClN6O3S |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-chloro-22,22-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,18,24-hexazatetracyclo[18.2.1.111,14.02,7]tetracosa-2(7),3,5,11(24),12-pentaen-8-one |
| SMILES | CC1(C)CC2CNCCCn3ccc(n3)S(=O)(=O)NC(=O)c3ccc(Cl)nc3N1C2 |
| InChI | InChI=1S/C19H25ClN6O3S/c1-19(2)10-13-11-21-7-3-8-25-9-6-16(23-25)30(28,29)24-18(27)14-4-5-15(20)22-17(14)26(19)12-13/h4-6,9,13,21H,3,7-8,10-12H2,1-2H3,(H,24,27) |
| InChIKey | JLCGCGNFBTWCLL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|