C42H36NP3S3 — CID 139429093
5,11,17-triethyl-8,14,22-triphenyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 139429093) has the molecular formula C42H36NP3S3 and a molecular weight of 743.88 g/mol. Its IUPAC name is 5,11,17-triethyl-8,14,22-triphenyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5,11,17-triethyl-8,14,22-triphenyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 139429093 |
| Molecular Formula | C42H36NP3S3 |
| Molecular Weight | 743.88 g/mol |
| Exact Mass | 743.12 |
| IUPAC Name | 5,11,17-triethyl-8,14,22-triphenyl-8,14,22-tris(sulfanylidene)-1-aza-8λ5,14λ5,22λ5-triphosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CCc1cc2c3c(c1)P(=S)(c1ccccc1)c1cc(CC)cc4c1N3c1c(cc(CC)cc1P4(=S)c1ccccc1)P2(=S)c1ccccc1 |
| InChI | InChI=1S/C42H36NP3S3/c1-4-28-22-34-40-35(23-28)45(48,32-18-12-8-13-19-32)37-25-30(6-3)27-39-42(37)43(40)41-36(44(34,47)31-16-10-7-11-17-31)24-29(5-2)26-38(41)46(39,49)33-20-14-9-15-21-33/h7-27H,4-6H2,1-3H3 |
| InChIKey | DCYRWIDEKZHYEA-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.88 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|