About N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine
N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine (PubChem CID 139430730) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine.
Molecular Properties
| Compound Name | N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine |
| PubChem CID | 139430730 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine |
| SMILES | C=C/C=C(\C)[C@@H](C)N=C(C)C |
| InChI | InChI=1S/C10H17N/c1-6-7-9(4)10(5)11-8(2)3/h6-7,10H,1H2,2-5H3/b9-7+/t10-/m1/s1 |
| InChIKey | NRULBXLUCCYEGS-TTZKWOQHSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine?
The IUPAC name of N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine (CID 139430730) is N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine.
What is the SMILES notation for N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine?
The canonical SMILES for N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine is C=C/C=C(\C)[C@@H](C)N=C(C)C.
What is the InChIKey of N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine?
The InChIKey is NRULBXLUCCYEGS-TTZKWOQHSA-N. The full InChI is InChI=1S/C10H17N/c1-6-7-9(4)10(5)11-8(2)3/h6-7,10H,1H2,2-5H3/b9-7+/t10-/m1/s1.
What are the key properties of N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine?
N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine has a molecular weight of 151.25 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3E)-3-methylhexa-3,5-dien-2-yl]propan-2-imine is sourced from PubChem (CID 139430730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).