About methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate
methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate (PubChem CID 139430776) has the molecular formula C11H15BrO2
and a molecular weight of 259.14 g/mol. Its IUPAC name is methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate |
| PubChem CID | 139430776 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate |
| SMILES | COC(=O)/C1=C/C/C=C(/Br)CC(C)C1 |
| InChI | InChI=1S/C11H15BrO2/c1-8-6-9(11(13)14-2)4-3-5-10(12)7-8/h4-5,8H,3,6-7H2,1-2H3/b9-4+,10-5+ |
| InChIKey | CNBKFDALOWAFTO-LUZURFALSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate?
The IUPAC name of methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate (CID 139430776) is methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate.
What is the SMILES notation for methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate?
The canonical SMILES for methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate is COC(=O)/C1=C/C/C=C(/Br)CC(C)C1.
What is the InChIKey of methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate?
The InChIKey is CNBKFDALOWAFTO-LUZURFALSA-N. The full InChI is InChI=1S/C11H15BrO2/c1-8-6-9(11(13)14-2)4-3-5-10(12)7-8/h4-5,8H,3,6-7H2,1-2H3/b9-4+,10-5+.
What are the key properties of methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate?
methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate has a molecular weight of 259.14 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1E,4E)-5-bromo-7-methylcycloocta-1,4-diene-1-carboxylate is sourced from PubChem (CID 139430776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).