C21H22F3N3 — CID 139430880
1-benzyl-4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)indole (PubChem CID 139430880) has the molecular formula C21H22F3N3 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-benzyl-4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)indole.
| Compound Name | 1-benzyl-4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)indole |
|---|---|
| PubChem CID | 139430880 |
| Molecular Formula | C21H22F3N3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-benzyl-4-(4-methylpiperazin-1-yl)-2-(trifluoromethyl)indole |
| SMILES | CN1CCN(c2cccc3c2cc(C(F)(F)F)n3Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22F3N3/c1-25-10-12-26(13-11-25)18-8-5-9-19-17(18)14-20(21(22,23)24)27(19)15-16-6-3-2-4-7-16/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | GJQFMDCAQBNWKX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |