About 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one
7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one (PubChem CID 139430953) has the molecular formula C23H23N3O2
and a molecular weight of 373.46 g/mol. Its IUPAC name is 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one.
Molecular Properties
| Compound Name | 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one |
| PubChem CID | 139430953 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one |
| SMILES | CC1CN(c2ccc3cc(-c4cc5ccccn5c4)c(=O)oc3c2)C[C@H](C)N1 |
| InChI | InChI=1S/C23H23N3O2/c1-15-12-26(13-16(2)24-15)20-7-6-17-10-21(23(27)28-22(17)11-20)18-9-19-5-3-4-8-25(19)14-18/h3-11,14-16,24H,12-13H2,1-2H3/t15-,16?/m0/s1 |
| InChIKey | PDRCQAUOAWNATE-VYRBHSGPSA-N |
| XLogP | 3.90 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one?
The IUPAC name of 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one (CID 139430953) is 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one.
What is the SMILES notation for 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one?
The canonical SMILES for 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one is CC1CN(c2ccc3cc(-c4cc5ccccn5c4)c(=O)oc3c2)C[C@H](C)N1.
What is the InChIKey of 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one?
The InChIKey is PDRCQAUOAWNATE-VYRBHSGPSA-N. The full InChI is InChI=1S/C23H23N3O2/c1-15-12-26(13-16(2)24-15)20-7-6-17-10-21(23(27)28-22(17)11-20)18-9-19-5-3-4-8-25(19)14-18/h3-11,14-16,24H,12-13H2,1-2H3/t15-,16?/m0/s1.
What are the key properties of 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one?
7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one has a molecular weight of 373.46 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3S)-3,5-dimethylpiperazin-1-yl]-3-indolizin-2-ylchromen-2-one is sourced from PubChem (CID 139430953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).