C20H25FN7O5P — CID 139431352
2-[[[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-fluorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoic acid (PubChem CID 139431352) has the molecular formula C20H25FN7O5P and a molecular weight of 493.44 g/mol. Its IUPAC name is 2-[[[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-fluorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-fluorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 139431352 |
| Molecular Formula | C20H25FN7O5P |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[[[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-fluorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoic acid |
| SMILES | C[C@@H](Cn1cnc2c(N)ncnc21)OCP(=O)(NC(=O)c1ccc(F)cc1)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C20H25FN7O5P/c1-12(8-28-10-25-15-16(22)23-9-24-17(15)28)33-11-34(32,27-20(2,3)19(30)31)26-18(29)13-4-6-14(21)7-5-13/h4-7,9-10,12H,8,11H2,1-3H3,(H,30,31)(H2,22,23,24)(H2,26,27,29,32)/t12-,34?/m0/s1 |
| InChIKey | VQOYHSMYXXQNNY-GZVXZICHSA-N |
| XLogP | 1.99 |
| TPSA | 174.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|