C26H23F2N5 — CID 139432190
(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(5-methyl-1H-pyrazol-4-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 139432190) has the molecular formula C26H23F2N5 and a molecular weight of 443.50 g/mol. Its IUPAC name is (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(5-methyl-1H-pyrazol-4-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(5-methyl-1H-pyrazol-4-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 139432190 |
| Molecular Formula | C26H23F2N5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[6-(5-methyl-1H-pyrazol-4-yl)-2-pyridinyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | Cc1[nH]ncc1-c1cccc([C@@]23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)n1 |
| InChI | InChI=1S/C26H23F2N5/c1-14-16(13-29-31-14)20-8-5-9-22(30-20)26-11-10-17(25(26,2)3)15-12-21(32-33-24(15)26)23-18(27)6-4-7-19(23)28/h4-9,12-13,17H,10-11H2,1-3H3,(H,29,31)/t17-,26-/m0/s1 |
| InChIKey | FYRLBXNJZTVZFC-QLXKLKPCSA-N |
| XLogP | 5.72 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |