C26H21F2N7 — CID 139432331
2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetonitrile (PubChem CID 139432331) has the molecular formula C26H21F2N7 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetonitrile.
| Compound Name | 2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 139432331 |
| Molecular Formula | C26H21F2N7 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[4-[6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]pyrazin-2-yl]pyrazol-1-yl]acetonitrile |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cncc(-c3cnn(CC#N)c3)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C26H21F2N7/c1-25(2)17-6-7-26(25,22-13-30-12-21(32-22)15-11-31-35(14-15)9-8-29)24-16(17)10-20(33-34-24)23-18(27)4-3-5-19(23)28/h3-5,10-14,17H,6-7,9H2,1-2H3/t17-,26-/m0/s1 |
| InChIKey | VEGHFVKUKIEPDD-QLXKLKPCSA-N |
| XLogP | 4.80 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |