About 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile
2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile (PubChem CID 139432640) has the molecular formula C23H22N4
and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile |
| PubChem CID | 139432640 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile |
| SMILES | N#CCN1C=CN(C(c2ccccc2)(c2ccccc2)C2C=CC=CC2)N1 |
| InChI | InChI=1S/C23H22N4/c24-16-17-26-18-19-27(25-26)23(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-14,18-19,22,25H,15,17H2 |
| InChIKey | GSGGWJJXBBARSD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile?
The IUPAC name of 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile (CID 139432640) is 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile.
What is the SMILES notation for 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile?
The canonical SMILES for 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile is N#CCN1C=CN(C(c2ccccc2)(c2ccccc2)C2C=CC=CC2)N1.
What is the InChIKey of 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile?
The InChIKey is GSGGWJJXBBARSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4/c24-16-17-26-18-19-27(25-26)23(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-14,18-19,22,25H,15,17H2.
What are the key properties of 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile?
2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile has a molecular weight of 354.46 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[cyclohexa-2,4-dien-1-yl(diphenyl)methyl]-2H-triazol-1-yl]acetonitrile is sourced from PubChem (CID 139432640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).