About 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol
4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol (PubChem CID 139433030) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol |
| PubChem CID | 139433030 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol |
| SMILES | C=C1C=C(C(C)(C)C)CC(=C)C1O |
| InChI | InChI=1S/C12H18O/c1-8-6-10(12(3,4)5)7-9(2)11(8)13/h6,11,13H,1-2,7H2,3-5H3 |
| InChIKey | IPIOWQBBKGINOO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol?
The IUPAC name of 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol (CID 139433030) is 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol.
What is the SMILES notation for 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol?
The canonical SMILES for 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol is C=C1C=C(C(C)(C)C)CC(=C)C1O.
What is the InChIKey of 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol?
The InChIKey is IPIOWQBBKGINOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-8-6-10(12(3,4)5)7-9(2)11(8)13/h6,11,13H,1-2,7H2,3-5H3.
What are the key properties of 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol?
4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol has a molecular weight of 178.27 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-dimethylidenecyclohex-3-en-1-ol is sourced from PubChem (CID 139433030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).