C19H20N4O4S — CID 139433355
1-[4-(dimethylsulfamoyl)phenyl]-3-methyl-5-oxo-N-phenyl-4H-pyrazole-4-carboxamide (PubChem CID 139433355) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 1-[4-(dimethylsulfamoyl)phenyl]-3-methyl-5-oxo-N-phenyl-4H-pyrazole-4-carboxamide.
| Compound Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-methyl-5-oxo-N-phenyl-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139433355 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-[4-(dimethylsulfamoyl)phenyl]-3-methyl-5-oxo-N-phenyl-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)N(C)C)cc2)C(=O)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H20N4O4S/c1-13-17(18(24)20-14-7-5-4-6-8-14)19(25)23(21-13)15-9-11-16(12-10-15)28(26,27)22(2)3/h4-12,17H,1-3H3,(H,20,24) |
| InChIKey | ZVVARFRVIMLEAM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|