C26H25F8N5O2S — CID 139433498
4-[[(1S,2S,4S)-4-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 139433498) has the molecular formula C26H25F8N5O2S and a molecular weight of 623.57 g/mol. Its IUPAC name is 4-[[(1S,2S,4S)-4-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-[[(1S,2S,4S)-4-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 139433498 |
| Molecular Formula | C26H25F8N5O2S |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | 4-[[(1S,2S,4S)-4-[3,5-bis(trifluoromethyl)phenyl]-2-(dimethylamino)cyclohexyl]amino]-2,5-difluoro-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | CN(C)[C@H]1C[C@@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2ccncn2)cc1F |
| InChI | InChI=1S/C26H25F8N5O2S/c1-39(2)22-9-14(15-7-16(25(29,30)31)10-17(8-15)26(32,33)34)3-4-20(22)37-21-11-19(28)23(12-18(21)27)42(40,41)38-24-5-6-35-13-36-24/h5-8,10-14,20,22,37H,3-4,9H2,1-2H3,(H,35,36,38)/t14-,20-,22-/m0/s1 |
| InChIKey | PQKUEUTWSSBONW-FSJXIACGSA-N |
| XLogP | 6.27 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |