C30H35ClF4N6O5S — CID 139433615
(2S)-2-amino-N-[(1S,2S,5S)-2-[2-chloro-5-fluoro-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-N,3-dimethylbutanamide;formic acid (PubChem CID 139433615) has the molecular formula C30H35ClF4N6O5S and a molecular weight of 703.16 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1S,2S,5S)-2-[2-chloro-5-fluoro-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-N,3-dimethylbutanamide;formic acid.
| Compound Name | (2S)-2-amino-N-[(1S,2S,5S)-2-[2-chloro-5-fluoro-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-N,3-dimethylbutanamide;formic acid |
|---|---|
| PubChem CID | 139433615 |
| Molecular Formula | C30H35ClF4N6O5S |
| Molecular Weight | 703.16 g/mol |
| Exact Mass | 702.20 |
| IUPAC Name | (2S)-2-amino-N-[(1S,2S,5S)-2-[2-chloro-5-fluoro-4-(pyrimidin-4-ylsulfamoyl)anilino]-5-[3-(trifluoromethyl)phenyl]cyclohexyl]-N,3-dimethylbutanamide;formic acid |
| SMILES | CC(C)[C@H](N)C(=O)N(C)[C@H]1C[C@@H](c2cccc(C(F)(F)F)c2)CC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2ccncn2)cc1Cl.O=CO |
| InChI | InChI=1S/C29H33ClF4N6O3S.CH2O2/c1-16(2)27(35)28(41)40(3)24-12-18(17-5-4-6-19(11-17)29(32,33)34)7-8-22(24)38-23-14-21(31)25(13-20(23)30)44(42,43)39-26-9-10-36-15-37-26;2-1-3/h4-6,9-11,13-16,18,22,24,27,38H,7-8,12,35H2,1-3H3,(H,36,37,39);1H,(H,2,3)/t18-,22-,24-,27-;/m0./s1 |
| InChIKey | PTGWQTFKPDQANM-NWEJVDRHSA-N |
| XLogP | 5.35 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.16 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|