C26H28ClF4N5O2S — CID 139433721
5-chloro-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(2,2,2-trifluoroethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 139433721) has the molecular formula C26H28ClF4N5O2S and a molecular weight of 586.06 g/mol. Its IUPAC name is 5-chloro-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(2,2,2-trifluoroethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 5-chloro-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(2,2,2-trifluoroethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 139433721 |
| Molecular Formula | C26H28ClF4N5O2S |
| Molecular Weight | 586.06 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | 5-chloro-4-[[(1S,2S,4S)-2-(dimethylamino)-4-[3-(2,2,2-trifluoroethyl)phenyl]cyclohexyl]amino]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | CN(C)[C@H]1C[C@@H](c2cccc(CC(F)(F)F)c2)CC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2ccncn2)cc1Cl |
| InChI | InChI=1S/C26H28ClF4N5O2S/c1-36(2)23-11-18(17-5-3-4-16(10-17)14-26(29,30)31)6-7-21(23)34-22-13-20(28)24(12-19(22)27)39(37,38)35-25-8-9-32-15-33-25/h3-5,8-10,12-13,15,18,21,23,34H,6-7,11,14H2,1-2H3,(H,32,33,35)/t18-,21-,23-/m0/s1 |
| InChIKey | BXRAEAJGPNWZCL-HARLFGEKSA-N |
| XLogP | 5.85 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.06 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |