C17H13N3O — CID 139433813
N,2-diphenylpyrimidine-4-carboxamide (PubChem CID 139433813) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is N,2-diphenylpyrimidine-4-carboxamide.
| Compound Name | N,2-diphenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 139433813 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N,2-diphenylpyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H13N3O/c21-17(19-14-9-5-2-6-10-14)15-11-12-18-16(20-15)13-7-3-1-4-8-13/h1-12H,(H,19,21) |
| InChIKey | XVLYIDSQDWSVHR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |