C9H13F6NO3 — CID 139433920
2,4,4-trifluoro-3-hydroxy-3-methyl-N-[(1S)-1-(2,2,2-trifluoroethoxy)ethyl]butanamide (PubChem CID 139433920) has the molecular formula C9H13F6NO3 and a molecular weight of 297.20 g/mol. Its IUPAC name is 2,4,4-trifluoro-3-hydroxy-3-methyl-N-[(1S)-1-(2,2,2-trifluoroethoxy)ethyl]butanamide.
| Compound Name | 2,4,4-trifluoro-3-hydroxy-3-methyl-N-[(1S)-1-(2,2,2-trifluoroethoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 139433920 |
| Molecular Formula | C9H13F6NO3 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,4,4-trifluoro-3-hydroxy-3-methyl-N-[(1S)-1-(2,2,2-trifluoroethoxy)ethyl]butanamide |
| SMILES | C[C@@H](NC(=O)C(F)C(C)(O)C(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C9H13F6NO3/c1-4(19-3-9(13,14)15)16-6(17)5(10)8(2,18)7(11)12/h4-5,7,18H,3H2,1-2H3,(H,16,17)/t4-,5?,8?/m0/s1 |
| InChIKey | PAIQYRMQBBGNDZ-ZHBRMIHBSA-N |
| XLogP | 1.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|