C18H17F6N5O2S — CID 139433941
2-[3-ethylsulfonyl-5-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (PubChem CID 139433941) has the molecular formula C18H17F6N5O2S and a molecular weight of 481.42 g/mol. Its IUPAC name is 2-[3-ethylsulfonyl-5-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-[3-ethylsulfonyl-5-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139433941 |
| Molecular Formula | C18H17F6N5O2S |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-[3-ethylsulfonyl-5-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-yl]-3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine |
| SMILES | CCS(=O)(=O)c1c(-c2nc3cc(C(F)(F)F)cnc3n2C)nn2c1CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C18H17F6N5O2S/c1-3-32(30,31)14-12-7-9(17(19,20)21)4-5-29(12)27-13(14)16-26-11-6-10(18(22,23)24)8-25-15(11)28(16)2/h6,8-9H,3-5,7H2,1-2H3 |
| InChIKey | QSHFMOOTIKWUNZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |