About 2-hexyl-2,5-dimethylpyrrole
2-hexyl-2,5-dimethylpyrrole (PubChem CID 139434018) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2-hexyl-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 2-hexyl-2,5-dimethylpyrrole |
| PubChem CID | 139434018 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2-hexyl-2,5-dimethylpyrrole |
| SMILES | CCCCCCC1(C)C=CC(C)=N1 |
| InChI | InChI=1S/C12H21N/c1-4-5-6-7-9-12(3)10-8-11(2)13-12/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | XXIDTJWOXJROME-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-2,5-dimethylpyrrole?
The IUPAC name of 2-hexyl-2,5-dimethylpyrrole (CID 139434018) is 2-hexyl-2,5-dimethylpyrrole.
What is the SMILES notation for 2-hexyl-2,5-dimethylpyrrole?
The canonical SMILES for 2-hexyl-2,5-dimethylpyrrole is CCCCCCC1(C)C=CC(C)=N1.
What is the InChIKey of 2-hexyl-2,5-dimethylpyrrole?
The InChIKey is XXIDTJWOXJROME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-4-5-6-7-9-12(3)10-8-11(2)13-12/h8,10H,4-7,9H2,1-3H3.
What are the key properties of 2-hexyl-2,5-dimethylpyrrole?
2-hexyl-2,5-dimethylpyrrole has a molecular weight of 179.31 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-2,5-dimethylpyrrole is sourced from PubChem (CID 139434018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).