About 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide
6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide (PubChem CID 139434519) has the molecular formula C7H7BrINO
and a molecular weight of 327.95 g/mol. Its IUPAC name is 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 139434519 |
| Molecular Formula | C7H7BrINO |
| Molecular Weight | 327.95 g/mol |
| Exact Mass | 326.88 |
| IUPAC Name | 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC=CC1(Br)I |
| InChI | InChI=1S/C7H7BrINO/c8-7(9)4-2-1-3-5(7)6(10)11/h1-5H,(H2,10,11) |
| InChIKey | YKHZDLJJVABUCI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.95 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide (CID 139434519) is 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide is NC(=O)C1C=CC=CC1(Br)I.
What is the InChIKey of 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide?
The InChIKey is YKHZDLJJVABUCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrINO/c8-7(9)4-2-1-3-5(7)6(10)11/h1-5H,(H2,10,11).
What are the key properties of 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide?
6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide has a molecular weight of 327.95 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-6-iodocyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 139434519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).