About [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine
[1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine (PubChem CID 139434665) has the molecular formula C15H18ClN3S
and a molecular weight of 307.85 g/mol. Its IUPAC name is [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine |
| PubChem CID | 139434665 |
| Molecular Formula | C15H18ClN3S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(CN)CCN(c2ncc(-c3ccccc3Cl)s2)C1 |
| InChI | InChI=1S/C15H18ClN3S/c1-15(9-17)6-7-19(10-15)14-18-8-13(20-14)11-4-2-3-5-12(11)16/h2-5,8H,6-7,9-10,17H2,1H3 |
| InChIKey | SQKFCCFADSAKOI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine?
The IUPAC name of [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine (CID 139434665) is [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine is CC1(CN)CCN(c2ncc(-c3ccccc3Cl)s2)C1.
What is the InChIKey of [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine?
The InChIKey is SQKFCCFADSAKOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3S/c1-15(9-17)6-7-19(10-15)14-18-8-13(20-14)11-4-2-3-5-12(11)16/h2-5,8H,6-7,9-10,17H2,1H3.
What are the key properties of [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine?
[1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine has a molecular weight of 307.85 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-methylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 139434665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).