About 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid
4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid (PubChem CID 139434991) has the molecular formula C9H5F2N3O3
and a molecular weight of 241.15 g/mol. Its IUPAC name is 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid |
| PubChem CID | 139434991 |
| Molecular Formula | C9H5F2N3O3 |
| Molecular Weight | 241.15 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]nnc1Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H5F2N3O3/c10-5-2-1-4(3-6(5)11)17-8-7(9(15)16)12-14-13-8/h1-3H,(H,15,16)(H,12,13,14) |
| InChIKey | RRNLZNVMGORNPW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid?
The IUPAC name of 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid (CID 139434991) is 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid.
What is the SMILES notation for 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid?
The canonical SMILES for 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid is O=C(O)c1[nH]nnc1Oc1ccc(F)c(F)c1.
What is the InChIKey of 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid?
The InChIKey is RRNLZNVMGORNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2N3O3/c10-5-2-1-4(3-6(5)11)17-8-7(9(15)16)12-14-13-8/h1-3H,(H,15,16)(H,12,13,14).
What are the key properties of 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid?
4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid has a molecular weight of 241.15 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenoxy)-1H-triazole-5-carboxylic acid is sourced from PubChem (CID 139434991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).