About benzene-1,3-diamine;naphthalene-1,5-diamine
benzene-1,3-diamine;naphthalene-1,5-diamine (PubChem CID 139435132) has the molecular formula C16H18N4
and a molecular weight of 266.35 g/mol. Its IUPAC name is benzene-1,3-diamine;naphthalene-1,5-diamine.
Molecular Properties
| Compound Name | benzene-1,3-diamine;naphthalene-1,5-diamine |
| PubChem CID | 139435132 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | benzene-1,3-diamine;naphthalene-1,5-diamine |
| SMILES | Nc1cccc(N)c1.Nc1cccc2c(N)cccc12 |
| InChI | InChI=1S/C10H10N2.C6H8N2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12;7-5-2-1-3-6(8)4-5/h1-6H,11-12H2;1-4H,7-8H2 |
| InChIKey | GSQZOTLOQJQKNO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-diamine;naphthalene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diamine;naphthalene-1,5-diamine?
The IUPAC name of benzene-1,3-diamine;naphthalene-1,5-diamine (CID 139435132) is benzene-1,3-diamine;naphthalene-1,5-diamine.
What is the SMILES notation for benzene-1,3-diamine;naphthalene-1,5-diamine?
The canonical SMILES for benzene-1,3-diamine;naphthalene-1,5-diamine is Nc1cccc(N)c1.Nc1cccc2c(N)cccc12.
What is the InChIKey of benzene-1,3-diamine;naphthalene-1,5-diamine?
The InChIKey is GSQZOTLOQJQKNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C6H8N2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12;7-5-2-1-3-6(8)4-5/h1-6H,11-12H2;1-4H,7-8H2.
What are the key properties of benzene-1,3-diamine;naphthalene-1,5-diamine?
benzene-1,3-diamine;naphthalene-1,5-diamine has a molecular weight of 266.35 g/mol, XLogP of 2.86, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diamine;naphthalene-1,5-diamine is sourced from PubChem (CID 139435132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).