About 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone
1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone (PubChem CID 139435361) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone |
| PubChem CID | 139435361 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(NC2CCOC(C)(C)C2)c1 |
| InChI | InChI=1S/C15H21NO2/c1-11(17)12-5-4-6-13(9-12)16-14-7-8-18-15(2,3)10-14/h4-6,9,14,16H,7-8,10H2,1-3H3 |
| InChIKey | CPHCYUPJSPUWHZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone?
The IUPAC name of 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone (CID 139435361) is 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone.
What is the SMILES notation for 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone?
The canonical SMILES for 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone is CC(=O)c1cccc(NC2CCOC(C)(C)C2)c1.
What is the InChIKey of 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone?
The InChIKey is CPHCYUPJSPUWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-11(17)12-5-4-6-13(9-12)16-14-7-8-18-15(2,3)10-14/h4-6,9,14,16H,7-8,10H2,1-3H3.
What are the key properties of 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone?
1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone has a molecular weight of 247.34 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2,2-dimethyloxan-4-yl)amino]phenyl]ethanone is sourced from PubChem (CID 139435361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).