C32H26N4O2 — CID 139435417
5,6-dimethoxy-2,9-bis(3-methyl-1H-indol-7-yl)-1,10-phenanthroline (PubChem CID 139435417) has the molecular formula C32H26N4O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 5,6-dimethoxy-2,9-bis(3-methyl-1H-indol-7-yl)-1,10-phenanthroline.
| Compound Name | 5,6-dimethoxy-2,9-bis(3-methyl-1H-indol-7-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 139435417 |
| Molecular Formula | C32H26N4O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 5,6-dimethoxy-2,9-bis(3-methyl-1H-indol-7-yl)-1,10-phenanthroline |
| SMILES | COc1c(OC)c2ccc(-c3cccc4c(C)c[nH]c34)nc2c2nc(-c3cccc4c(C)c[nH]c34)ccc12 |
| InChI | InChI=1S/C32H26N4O2/c1-17-15-33-27-19(17)7-5-9-21(27)25-13-11-23-29(35-25)30-24(32(38-4)31(23)37-3)12-14-26(36-30)22-10-6-8-20-18(2)16-34-28(20)22/h5-16,33-34H,1-4H3 |
| InChIKey | ULEKREMSEVUEQA-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|