C12H19NS — CID 139435535
(5Z,7Z)-9-ethyl-6-propan-2-yl-4,9-dihydro-1,3-thiazonine (PubChem CID 139435535) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is (5Z,7Z)-9-ethyl-6-propan-2-yl-4,9-dihydro-1,3-thiazonine.
| Compound Name | (5Z,7Z)-9-ethyl-6-propan-2-yl-4,9-dihydro-1,3-thiazonine |
|---|---|
| PubChem CID | 139435535 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (5Z,7Z)-9-ethyl-6-propan-2-yl-4,9-dihydro-1,3-thiazonine |
| SMILES | CCC1/C=C\C(C(C)C)=C/C/N=C\S1 |
| InChI | InChI=1S/C12H19NS/c1-4-12-6-5-11(10(2)3)7-8-13-9-14-12/h5-7,9-10,12H,4,8H2,1-3H3/b6-5-,11-7+,13-9- |
| InChIKey | BNOJNTRFKDVXAB-QFDGDHPTSA-N |
| XLogP | 3.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |