About (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine
(2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine (PubChem CID 139435606) has the molecular formula C9H14ClN
and a molecular weight of 171.67 g/mol. Its IUPAC name is (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine.
Molecular Properties
| Compound Name | (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine |
| PubChem CID | 139435606 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine |
| SMILES | C=CC(Cl)C/C=C(C)/C=N/C |
| InChI | InChI=1S/C9H14ClN/c1-4-9(10)6-5-8(2)7-11-3/h4-5,7,9H,1,6H2,2-3H3/b8-5+,11-7+ |
| InChIKey | DAXGOHIHLGJMMF-FBSVACHXSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine?
The IUPAC name of (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine (CID 139435606) is (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine.
What is the SMILES notation for (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine?
The canonical SMILES for (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine is C=CC(Cl)C/C=C(C)/C=N/C.
What is the InChIKey of (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine?
The InChIKey is DAXGOHIHLGJMMF-FBSVACHXSA-N. The full InChI is InChI=1S/C9H14ClN/c1-4-9(10)6-5-8(2)7-11-3/h4-5,7,9H,1,6H2,2-3H3/b8-5+,11-7+.
What are the key properties of (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine?
(2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine has a molecular weight of 171.67 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5-chloro-N,2-dimethylhepta-2,6-dien-1-imine is sourced from PubChem (CID 139435606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).