About 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine
5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine (PubChem CID 139435827) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine |
| PubChem CID | 139435827 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine |
| SMILES | C=c1ncnc2c1=C(C)N=C2 |
| InChI | InChI=1S/C8H7N3/c1-5-8-6(2)10-4-11-7(8)3-9-5/h3-4H,2H2,1H3 |
| InChIKey | QECTTZCWJFSQPU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine?
The IUPAC name of 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine (CID 139435827) is 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine is C=c1ncnc2c1=C(C)N=C2.
What is the InChIKey of 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine?
The InChIKey is QECTTZCWJFSQPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c1-5-8-6(2)10-4-11-7(8)3-9-5/h3-4H,2H2,1H3.
What are the key properties of 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine?
5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine has a molecular weight of 145.16 g/mol, XLogP of -0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-methylidenepyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 139435827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).