C28H11N5 — CID 139436030
10-azahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene-12,13,14,15-tetracarbonitrile (PubChem CID 139436030) has the molecular formula C28H11N5 and a molecular weight of 417.43 g/mol. Its IUPAC name is 10-azahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene-12,13,14,15-tetracarbonitrile.
| Compound Name | 10-azahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene-12,13,14,15-tetracarbonitrile |
|---|---|
| PubChem CID | 139436030 |
| Molecular Formula | C28H11N5 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 10-azahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-1(17),2,4,6,8,11,13,15,18,20,22,24-dodecaene-12,13,14,15-tetracarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)c2c(c1C#N)c1ccc3ccccc3c1c1c3ccccc3cn21 |
| InChI | InChI=1S/C28H11N5/c29-11-21-22(12-30)24(14-32)28-26(23(21)13-31)20-10-9-16-5-1-3-7-18(16)25(20)27-19-8-4-2-6-17(19)15-33(27)28/h1-10,15H |
| InChIKey | HKKPLNGFQSYOGZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 99.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|