C25H9N5 — CID 139436094
12-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene-3,4,5,6-tetracarbonitrile (PubChem CID 139436094) has the molecular formula C25H9N5 and a molecular weight of 379.38 g/mol. Its IUPAC name is 12-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene-3,4,5,6-tetracarbonitrile.
| Compound Name | 12-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene-3,4,5,6-tetracarbonitrile |
|---|---|
| PubChem CID | 139436094 |
| Molecular Formula | C25H9N5 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 12-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene-3,4,5,6-tetracarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)c2c3ccc4ccccc4c3c3ncccc3c2c1C#N |
| InChI | InChI=1S/C25H9N5/c26-10-18-19(11-27)21(13-29)23-17-6-3-9-30-25(17)24-15-5-2-1-4-14(15)7-8-16(24)22(23)20(18)12-28/h1-9H |
| InChIKey | XGAFBCWZMBMECS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 108.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|