C13H10N2 — CID 139436249
6-methyl-8-methylidene-4,12-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 139436249) has the molecular formula C13H10N2 and a molecular weight of 194.24 g/mol. Its IUPAC name is 6-methyl-8-methylidene-4,12-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-methyl-8-methylidene-4,12-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 139436249 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 6-methyl-8-methylidene-4,12-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | C=C1c2ccncc2-c2cncc(C)c21 |
| InChI | InChI=1S/C13H10N2/c1-8-5-15-7-12-11-6-14-4-3-10(11)9(2)13(8)12/h3-7H,2H2,1H3 |
| InChIKey | ZMXYNHYMGTVDMD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |