About methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene
methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene (PubChem CID 139436610) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene.
Molecular Properties
| Compound Name | methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene |
| PubChem CID | 139436610 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene |
| SMILES | C/N=N/C=C\C=C/CC(C)C |
| InChI | InChI=1S/C9H16N2/c1-9(2)7-5-4-6-8-11-10-3/h4-6,8-9H,7H2,1-3H3/b5-4-,8-6-,11-10+ |
| InChIKey | FDGICXNWJXELNM-UGZLTBGYSA-N |
| XLogP | 3.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene?
The IUPAC name of methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene (CID 139436610) is methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene.
What is the SMILES notation for methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene?
The canonical SMILES for methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene is C/N=N/C=C\C=C/CC(C)C.
What is the InChIKey of methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene?
The InChIKey is FDGICXNWJXELNM-UGZLTBGYSA-N. The full InChI is InChI=1S/C9H16N2/c1-9(2)7-5-4-6-8-11-10-3/h4-6,8-9H,7H2,1-3H3/b5-4-,8-6-,11-10+.
What are the key properties of methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene?
methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene has a molecular weight of 152.24 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[(1Z,3Z)-6-methylhepta-1,3-dienyl]diazene is sourced from PubChem (CID 139436610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).