C29H31N3O3S — CID 1394367
2-[[(4R)-3-cyano-4-(2-ethoxyphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 1394367) has the molecular formula C29H31N3O3S and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-[[(4R)-3-cyano-4-(2-ethoxyphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[(4R)-3-cyano-4-(2-ethoxyphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 1394367 |
| Molecular Formula | C29H31N3O3S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 2-[[(4R)-3-cyano-4-(2-ethoxyphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinolin-2-yl]sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCOc1ccccc1[C@H]1C(C#N)=C(SCC(=O)Nc2c(C)cc(C)cc2C)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C29H31N3O3S/c1-5-35-24-12-7-6-9-20(24)26-21(15-30)29(31-22-10-8-11-23(33)27(22)26)36-16-25(34)32-28-18(3)13-17(2)14-19(28)4/h6-7,9,12-14,26,31H,5,8,10-11,16H2,1-4H3,(H,32,34)/t26-/m0/s1 |
| InChIKey | XRCOYDXNKCAAPF-SANMLTNESA-N |
| XLogP | 5.81 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |