About 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal
5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal (PubChem CID 139437220) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal.
Molecular Properties
| Compound Name | 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal |
| PubChem CID | 139437220 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal |
| SMILES | C=CC(=C)C(C/C=C/COCCCCC=O)CCCC |
| InChI | InChI=1S/C18H30O2/c1-4-6-12-18(17(3)5-2)13-8-11-16-20-15-10-7-9-14-19/h5,8,11,14,18H,2-4,6-7,9-10,12-13,15-16H2,1H3/b11-8+ |
| InChIKey | LKOFMMVDRXCMQM-DHZHZOJOSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal?
The IUPAC name of 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal (CID 139437220) is 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal.
What is the SMILES notation for 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal?
The canonical SMILES for 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal is C=CC(=C)C(C/C=C/COCCCCC=O)CCCC.
What is the InChIKey of 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal?
The InChIKey is LKOFMMVDRXCMQM-DHZHZOJOSA-N. The full InChI is InChI=1S/C18H30O2/c1-4-6-12-18(17(3)5-2)13-8-11-16-20-15-10-7-9-14-19/h5,8,11,14,18H,2-4,6-7,9-10,12-13,15-16H2,1H3/b11-8+.
What are the key properties of 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal?
5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal has a molecular weight of 278.44 g/mol, XLogP of 4.87, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-5-buta-1,3-dien-2-ylnon-2-enoxy]pentanal is sourced from PubChem (CID 139437220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).