C8H15N3 — CID 139437868
(1Z)-1-N'-[(Z)-2-aminoethenyl]-1-N',3-dimethylbuta-1,3-diene-1,1-diamine (PubChem CID 139437868) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is (1Z)-1-N'-[(Z)-2-aminoethenyl]-1-N',3-dimethylbuta-1,3-diene-1,1-diamine.
| Compound Name | (1Z)-1-N'-[(Z)-2-aminoethenyl]-1-N',3-dimethylbuta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 139437868 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (1Z)-1-N'-[(Z)-2-aminoethenyl]-1-N',3-dimethylbuta-1,3-diene-1,1-diamine |
| SMILES | C=C(C)/C=C(/N)N(C)/C=C\N |
| InChI | InChI=1S/C8H15N3/c1-7(2)6-8(10)11(3)5-4-9/h4-6H,1,9-10H2,2-3H3/b5-4-,8-6- |
| InChIKey | CZEJDGNGBHMSKP-NADLECRISA-N |
| XLogP | 0.72 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|