C30H52O7 — CID 139437987
ethyl 5-acetyloxy-2-[3-(4-tert-butyl-2,5-dioxooxolan-3-yl)-3-methylbutan-2-yl]-3,3,4,4,6,6-hexamethylheptanoate (PubChem CID 139437987) has the molecular formula C30H52O7 and a molecular weight of 524.74 g/mol. Its IUPAC name is ethyl 5-acetyloxy-2-[3-(4-tert-butyl-2,5-dioxooxolan-3-yl)-3-methylbutan-2-yl]-3,3,4,4,6,6-hexamethylheptanoate.
| Compound Name | ethyl 5-acetyloxy-2-[3-(4-tert-butyl-2,5-dioxooxolan-3-yl)-3-methylbutan-2-yl]-3,3,4,4,6,6-hexamethylheptanoate |
|---|---|
| PubChem CID | 139437987 |
| Molecular Formula | C30H52O7 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | ethyl 5-acetyloxy-2-[3-(4-tert-butyl-2,5-dioxooxolan-3-yl)-3-methylbutan-2-yl]-3,3,4,4,6,6-hexamethylheptanoate |
| SMILES | CCOC(=O)C(C(C)C(C)(C)C1C(=O)OC(=O)C1C(C)(C)C)C(C)(C)C(C)(C)C(OC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C30H52O7/c1-16-35-22(32)19(29(12,13)30(14,15)25(27(7,8)9)36-18(3)31)17(2)28(10,11)21-20(26(4,5)6)23(33)37-24(21)34/h17,19-21,25H,16H2,1-15H3 |
| InChIKey | QZNYNIJXBOCVNG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|