C36H36F2O6 — CID 139438421
2,2-difluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde (PubChem CID 139438421) has the molecular formula C36H36F2O6 and a molecular weight of 602.67 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde.
| Compound Name | 2,2-difluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 139438421 |
| Molecular Formula | C36H36F2O6 |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 2,2-difluoro-2-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
| SMILES | O=CC(F)(F)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H36F2O6/c37-36(38,26-39)35-34(43-24-30-19-11-4-12-20-30)33(42-23-29-17-9-3-10-18-29)32(41-22-28-15-7-2-8-16-28)31(44-35)25-40-21-27-13-5-1-6-14-27/h1-20,26,31-35H,21-25H2/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | OICRKVDQDOMBJZ-CKQPALCZSA-N |
| XLogP | 6.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|