C10H8F7NO — CID 139438484
N-cyclohexa-1,3-dien-1-yl-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 139438484) has the molecular formula C10H8F7NO and a molecular weight of 291.17 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 139438484 |
| Molecular Formula | C10H8F7NO |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(NC1=CC=CCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H8F7NO/c11-8(12,9(13,14)10(15,16)17)7(19)18-6-4-2-1-3-5-6/h1-2,4H,3,5H2,(H,18,19) |
| InChIKey | YTEYQIHSJREEFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|