About (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine
(4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine (PubChem CID 139438549) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine.
Molecular Properties
| Compound Name | (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine |
| PubChem CID | 139438549 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine |
| SMILES | C=C(/C=C(C)\C=N\C)C(=C)NCCC |
| InChI | InChI=1S/C12H20N2/c1-6-7-14-12(4)11(3)8-10(2)9-13-5/h8-9,14H,3-4,6-7H2,1-2,5H3/b10-8-,13-9+ |
| InChIKey | JLBCQBGGFIEKBZ-KKCPJAHZSA-N |
| XLogP | 2.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine?
The IUPAC name of (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine (CID 139438549) is (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine.
What is the SMILES notation for (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine?
The canonical SMILES for (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine is C=C(/C=C(C)\C=N\C)C(=C)NCCC.
What is the InChIKey of (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine?
The InChIKey is JLBCQBGGFIEKBZ-KKCPJAHZSA-N. The full InChI is InChI=1S/C12H20N2/c1-6-7-14-12(4)11(3)8-10(2)9-13-5/h8-9,14H,3-4,6-7H2,1-2,5H3/b10-8-,13-9+.
What are the key properties of (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine?
(4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine has a molecular weight of 192.31 g/mol, XLogP of 2.70, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-5-methyl-3-methylidene-6-methylimino-N-propylhexa-1,4-dien-2-amine is sourced from PubChem (CID 139438549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).