About (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one
(4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one (PubChem CID 139438893) has the molecular formula C11H15F3O3
and a molecular weight of 252.23 g/mol. Its IUPAC name is (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one.
Molecular Properties
| Compound Name | (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one |
| PubChem CID | 139438893 |
| Molecular Formula | C11H15F3O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one |
| SMILES | COC(/C=C\C(C)C(C)=O)=C(/C)OC(F)(F)F |
| InChI | InChI=1S/C11H15F3O3/c1-7(8(2)15)5-6-10(16-4)9(3)17-11(12,13)14/h5-7H,1-4H3/b6-5-,10-9- |
| InChIKey | QAPJKDAJCHQRMT-WBHJMADESA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one?
The IUPAC name of (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one (CID 139438893) is (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one.
What is the SMILES notation for (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one?
The canonical SMILES for (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one is COC(/C=C\C(C)C(C)=O)=C(/C)OC(F)(F)F.
What is the InChIKey of (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one?
The InChIKey is QAPJKDAJCHQRMT-WBHJMADESA-N. The full InChI is InChI=1S/C11H15F3O3/c1-7(8(2)15)5-6-10(16-4)9(3)17-11(12,13)14/h5-7H,1-4H3/b6-5-,10-9-.
What are the key properties of (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one?
(4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one has a molecular weight of 252.23 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-6-methoxy-3-methyl-7-(trifluoromethoxy)octa-4,6-dien-2-one is sourced from PubChem (CID 139438893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).