C22H24N4O2 — CID 139439044
7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-pyrrolo[1,2-a]pyrimidin-7-yl-2H-chromen-2-ol (PubChem CID 139439044) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-pyrrolo[1,2-a]pyrimidin-7-yl-2H-chromen-2-ol.
| Compound Name | 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-pyrrolo[1,2-a]pyrimidin-7-yl-2H-chromen-2-ol |
|---|---|
| PubChem CID | 139439044 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-pyrrolo[1,2-a]pyrimidin-7-yl-2H-chromen-2-ol |
| SMILES | C[C@@H]1CN(c2ccc3c(c2)OC(O)C(c2cc4ncccn4c2)=C3)C[C@H](C)N1 |
| InChI | InChI=1S/C22H24N4O2/c1-14-11-26(12-15(2)24-14)18-5-4-16-8-19(22(27)28-20(16)10-18)17-9-21-23-6-3-7-25(21)13-17/h3-10,13-15,22,24,27H,11-12H2,1-2H3/t14-,15+,22? |
| InChIKey | TYBZRDJSRUMWNK-SZLXDWMPSA-N |
| XLogP | 2.77 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|