C15H26N2O3 — CID 139439311
(2E,4E,6Z)-N-(1-methoxy-4-methylpentan-2-yl)-5-nitroocta-2,4,6-trien-1-amine (PubChem CID 139439311) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2E,4E,6Z)-N-(1-methoxy-4-methylpentan-2-yl)-5-nitroocta-2,4,6-trien-1-amine.
| Compound Name | (2E,4E,6Z)-N-(1-methoxy-4-methylpentan-2-yl)-5-nitroocta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 139439311 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (2E,4E,6Z)-N-(1-methoxy-4-methylpentan-2-yl)-5-nitroocta-2,4,6-trien-1-amine |
| SMILES | C/C=C\C(=C/C=C/CNC(COC)CC(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C15H26N2O3/c1-5-8-15(17(18)19)9-6-7-10-16-14(12-20-4)11-13(2)3/h5-9,13-14,16H,10-12H2,1-4H3/b7-6+,8-5-,15-9+ |
| InChIKey | LIVUIVUQIVWZBH-KFWCUIQDSA-N |
| XLogP | 2.93 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|