About N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide
N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide (PubChem CID 139439326) has the molecular formula C12H22F2N2O2S
and a molecular weight of 296.38 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide.
Molecular Properties
| Compound Name | N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide |
| PubChem CID | 139439326 |
| Molecular Formula | C12H22F2N2O2S |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide |
| SMILES | C=CCC(F)(F)CCS(=O)(=O)NC1CCC(N)CC1 |
| InChI | InChI=1S/C12H22F2N2O2S/c1-2-7-12(13,14)8-9-19(17,18)16-11-5-3-10(15)4-6-11/h2,10-11,16H,1,3-9,15H2 |
| InChIKey | ZBKLXQBGGQEBIH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide?
The IUPAC name of N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide (CID 139439326) is N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide.
What is the SMILES notation for N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide?
The canonical SMILES for N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide is C=CCC(F)(F)CCS(=O)(=O)NC1CCC(N)CC1.
What is the InChIKey of N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide?
The InChIKey is ZBKLXQBGGQEBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2O2S/c1-2-7-12(13,14)8-9-19(17,18)16-11-5-3-10(15)4-6-11/h2,10-11,16H,1,3-9,15H2.
What are the key properties of N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide?
N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide has a molecular weight of 296.38 g/mol, XLogP of 1.78, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminocyclohexyl)-3,3-difluorohex-5-ene-1-sulfonamide is sourced from PubChem (CID 139439326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).