C24H32FN5 — CID 139439391
2-[4-cyclobutyl-2-fluoro-3-[4-[[(3Z)-5-iminopenta-1,3-dien-2-yl]amino]-3-methylbutyl]phenyl]-1,2-dihydropyrazin-5-amine (PubChem CID 139439391) has the molecular formula C24H32FN5 and a molecular weight of 409.55 g/mol. Its IUPAC name is 2-[4-cyclobutyl-2-fluoro-3-[4-[[(3Z)-5-iminopenta-1,3-dien-2-yl]amino]-3-methylbutyl]phenyl]-1,2-dihydropyrazin-5-amine.
| Compound Name | 2-[4-cyclobutyl-2-fluoro-3-[4-[[(3Z)-5-iminopenta-1,3-dien-2-yl]amino]-3-methylbutyl]phenyl]-1,2-dihydropyrazin-5-amine |
|---|---|
| PubChem CID | 139439391 |
| Molecular Formula | C24H32FN5 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 2-[4-cyclobutyl-2-fluoro-3-[4-[[(3Z)-5-iminopenta-1,3-dien-2-yl]amino]-3-methylbutyl]phenyl]-1,2-dihydropyrazin-5-amine |
| SMILES | [H]/N=C/C=C\C(=C)NCC(C)CCc1c(C2CCC2)ccc(C2C=NC(N)=CN2)c1F |
| InChI | InChI=1S/C24H32FN5/c1-16(13-28-17(2)5-4-12-26)8-9-20-19(18-6-3-7-18)10-11-21(24(20)25)22-14-30-23(27)15-29-22/h4-5,10-12,14-16,18,22,26,28-29H,2-3,6-9,13,27H2,1H3/b5-4-,26-12+ |
| InChIKey | SABJHJODXDEIKB-JWQXYJINSA-N |
| XLogP | 4.44 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|